About (3-acetylphenyl) 4-thiophen-2-ylbutanoate
(3-acetylphenyl) 4-thiophen-2-ylbutanoate (PubChem CID 86975484) has the molecular formula C16H16O3S
and a molecular weight of 288.37 g/mol. Its IUPAC name is (3-acetylphenyl) 4-thiophen-2-ylbutanoate.
Molecular Properties
| Compound Name | (3-acetylphenyl) 4-thiophen-2-ylbutanoate |
| PubChem CID | 86975484 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (3-acetylphenyl) 4-thiophen-2-ylbutanoate |
| SMILES | CC(=O)c1cccc(OC(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C16H16O3S/c1-12(17)13-5-2-6-14(11-13)19-16(18)9-3-7-15-8-4-10-20-15/h2,4-6,8,10-11H,3,7,9H2,1H3 |
| InChIKey | HRGUWKQGTZOIHH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetylphenyl) 4-thiophen-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylphenyl) 4-thiophen-2-ylbutanoate?
The IUPAC name of (3-acetylphenyl) 4-thiophen-2-ylbutanoate (CID 86975484) is (3-acetylphenyl) 4-thiophen-2-ylbutanoate.
What is the SMILES notation for (3-acetylphenyl) 4-thiophen-2-ylbutanoate?
The canonical SMILES for (3-acetylphenyl) 4-thiophen-2-ylbutanoate is CC(=O)c1cccc(OC(=O)CCCc2cccs2)c1.
What is the InChIKey of (3-acetylphenyl) 4-thiophen-2-ylbutanoate?
The InChIKey is HRGUWKQGTZOIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3S/c1-12(17)13-5-2-6-14(11-13)19-16(18)9-3-7-15-8-4-10-20-15/h2,4-6,8,10-11H,3,7,9H2,1H3.
What are the key properties of (3-acetylphenyl) 4-thiophen-2-ylbutanoate?
(3-acetylphenyl) 4-thiophen-2-ylbutanoate has a molecular weight of 288.37 g/mol, XLogP of 3.88, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylphenyl) 4-thiophen-2-ylbutanoate is sourced from PubChem (CID 86975484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).