C20H28F3N3O2 — CID 86984105
N-butyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-4-carboxamide (PubChem CID 86984105) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is N-butyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86984105 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-butyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(C(C)C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H28F3N3O2/c1-3-4-11-24-19(28)15-9-12-26(13-10-15)14(2)18(27)25-17-7-5-16(6-8-17)20(21,22)23/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | YZWIQJZJWRGZHU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|