C19H33N5O2 — CID 86984110
N-butyl-1-[1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl]piperidine-4-carboxamide (PubChem CID 86984110) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-butyl-1-[1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86984110 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | N-butyl-1-[1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(C(C)C(=O)Nc2c(C)nn(C)c2C)CC1 |
| InChI | InChI=1S/C19H33N5O2/c1-6-7-10-20-19(26)16-8-11-24(12-9-16)15(4)18(25)21-17-13(2)22-23(5)14(17)3/h15-16H,6-12H2,1-5H3,(H,20,26)(H,21,25) |
| InChIKey | QHOYDEQWJBXNDD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|