C19H27Cl2N3O2 — CID 37211402
N-butyl-1-[(2S)-1-(3,4-dichloroanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 37211402) has the molecular formula C19H27Cl2N3O2 and a molecular weight of 400.35 g/mol. Its IUPAC name is N-butyl-1-[(2S)-1-(3,4-dichloroanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[(2S)-1-(3,4-dichloroanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 37211402 |
| Molecular Formula | C19H27Cl2N3O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-butyl-1-[(2S)-1-(3,4-dichloroanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN([C@@H](C)C(=O)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O2/c1-3-4-9-22-19(26)14-7-10-24(11-8-14)13(2)18(25)23-15-5-6-16(20)17(21)12-15/h5-6,12-14H,3-4,7-11H2,1-2H3,(H,22,26)(H,23,25)/t13-/m0/s1 |
| InChIKey | FZJBMKHVVIKVQV-ZDUSSCGKSA-N |
| XLogP | 3.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|