C12H18N2O3S2 — CID 86989604
2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]-N-prop-2-enylpropanamide (PubChem CID 86989604) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 86989604 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)S(=O)(=O)Cc1csc(CC)n1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-4-6-13-12(15)9(3)19(16,17)8-10-7-18-11(5-2)14-10/h4,7,9H,1,5-6,8H2,2-3H3,(H,13,15) |
| InChIKey | PRUSYSJYJXKMON-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|