C11H17N3OS — CID 61043268
2-[(4-methyl-1,3-thiazol-2-yl)methylamino]-N-prop-2-enylpropanamide (PubChem CID 61043268) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 61043268 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NCc1nc(C)cs1 |
| InChI | InChI=1S/C11H17N3OS/c1-4-5-12-11(15)9(3)13-6-10-14-8(2)7-16-10/h4,7,9,13H,1,5-6H2,2-3H3,(H,12,15) |
| InChIKey | YUZCVDULRFZHER-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|