C16H21FN2O4 — CID 86994017
methyl 3-[3-(cyclopropylmethoxy)propylcarbamoylamino]-4-fluorobenzoate (PubChem CID 86994017) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is methyl 3-[3-(cyclopropylmethoxy)propylcarbamoylamino]-4-fluorobenzoate.
| Compound Name | methyl 3-[3-(cyclopropylmethoxy)propylcarbamoylamino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 86994017 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 3-[3-(cyclopropylmethoxy)propylcarbamoylamino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)NCCCOCC2CC2)c1 |
| InChI | InChI=1S/C16H21FN2O4/c1-22-15(20)12-5-6-13(17)14(9-12)19-16(21)18-7-2-8-23-10-11-3-4-11/h5-6,9,11H,2-4,7-8,10H2,1H3,(H2,18,19,21) |
| InChIKey | AZSZGYYKTVSXBU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|