C20H26N4O2S — CID 86994127
1-(2-phenylsulfanylethyl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea (PubChem CID 86994127) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-(2-phenylsulfanylethyl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea.
| Compound Name | 1-(2-phenylsulfanylethyl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86994127 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-(2-phenylsulfanylethyl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)NCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-15(2)23-20(26)24-17-10-8-16(9-11-17)14-22-19(25)21-12-13-27-18-6-4-3-5-7-18/h3-11,15H,12-14H2,1-2H3,(H2,21,22,25)(H2,23,24,26) |
| InChIKey | XXRKJGXEUVAYDZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|