C22H31N3O2 — CID 86994180
1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea (PubChem CID 86994180) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea.
| Compound Name | 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86994180 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea |
| SMILES | CC(C)Oc1cccc(C(C)NC(=O)NCc2ccc(CN(C)C)cc2)c1 |
| InChI | InChI=1S/C22H31N3O2/c1-16(2)27-21-8-6-7-20(13-21)17(3)24-22(26)23-14-18-9-11-19(12-10-18)15-25(4)5/h6-13,16-17H,14-15H2,1-5H3,(H2,23,24,26) |
| InChIKey | HEXYXTRAMFVYLT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |