C21H34N4O — CID 86994951
1-(1-cyclopropylpiperidin-4-yl)-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]urea (PubChem CID 86994951) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-(1-cyclopropylpiperidin-4-yl)-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]urea.
| Compound Name | 1-(1-cyclopropylpiperidin-4-yl)-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 86994951 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 1-(1-cyclopropylpiperidin-4-yl)-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]urea |
| SMILES | CC(C)N(C)Cc1ccccc1CNC(=O)NC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-16(2)24(3)15-18-7-5-4-6-17(18)14-22-21(26)23-19-10-12-25(13-11-19)20-8-9-20/h4-7,16,19-20H,8-15H2,1-3H3,(H2,22,23,26) |
| InChIKey | OHMBMVFKRZCYIJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |