C21H19FN2O2S — CID 87006965
N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-thiophen-3-ylpropanamide (PubChem CID 87006965) has the molecular formula C21H19FN2O2S and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 87006965 |
| Molecular Formula | C21H19FN2O2S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)Nc1ccc(F)c(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H19FN2O2S/c22-18-8-7-17(23-20(25)9-6-16-10-11-27-14-16)13-19(18)24-21(26)12-15-4-2-1-3-5-15/h1-5,7-8,10-11,13-14H,6,9,12H2,(H,23,25)(H,24,26) |
| InChIKey | YPTVEHCTDCPRMO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |