C13H20N6OS — CID 87009371
5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1-(oxolan-2-ylmethyl)tetrazole (PubChem CID 87009371) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1-(oxolan-2-ylmethyl)tetrazole.
| Compound Name | 5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1-(oxolan-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 87009371 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1-(oxolan-2-ylmethyl)tetrazole |
| SMILES | Cn1cc(CCCSc2nnnn2CC2CCCO2)cn1 |
| InChI | InChI=1S/C13H20N6OS/c1-18-9-11(8-14-18)4-3-7-21-13-15-16-17-19(13)10-12-5-2-6-20-12/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | GPLHJLAEBBAKQC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|