C15H16BrN3O4 — CID 87010073
methyl N-[3-[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]phenyl]carbamate (PubChem CID 87010073) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is methyl N-[3-[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]phenyl]carbamate.
| Compound Name | methyl N-[3-[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87010073 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | methyl N-[3-[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)N(C)Cc2ccc(Br)o2)c1 |
| InChI | InChI=1S/C15H16BrN3O4/c1-19(9-12-6-7-13(16)23-12)14(20)17-10-4-3-5-11(8-10)18-15(21)22-2/h3-8H,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | OWHOLYAZDZYSOU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |