C22H26ClN3O2 — CID 87010445
2-(2-chlorophenyl)-N-[3-(diethylcarbamoyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 87010445) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-(diethylcarbamoyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-(diethylcarbamoyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87010445 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-(diethylcarbamoyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)N2CCCC2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-3-25(4-2)21(27)16-9-7-10-17(15-16)24-22(28)26-14-8-13-20(26)18-11-5-6-12-19(18)23/h5-7,9-12,15,20H,3-4,8,13-14H2,1-2H3,(H,24,28) |
| InChIKey | HBLBGFBEPOIGMK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |