C17H21N3O3S — CID 87011948
N-[4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]thiophene-3-carboxamide (PubChem CID 87011948) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]thiophene-3-carboxamide.
| Compound Name | N-[4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 87011948 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]thiophene-3-carboxamide |
| SMILES | N#CC(C(=O)CCNC(=O)c1ccsc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21N3O3S/c18-10-14(17(23)20-13-4-2-1-3-5-13)15(21)6-8-19-16(22)12-7-9-24-11-12/h7,9,11,13-14H,1-6,8H2,(H,19,22)(H,20,23) |
| InChIKey | FIHBSSDSCCDXMZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|