C18H20N2O3 — CID 98200987
(2R)-2-cyano-N-cyclopentyl-3,6-dioxo-6-phenylhexanamide (PubChem CID 98200987) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R)-2-cyano-N-cyclopentyl-3,6-dioxo-6-phenylhexanamide.
| Compound Name | (2R)-2-cyano-N-cyclopentyl-3,6-dioxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 98200987 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R)-2-cyano-N-cyclopentyl-3,6-dioxo-6-phenylhexanamide |
| SMILES | N#C[C@H](C(=O)CCC(=O)c1ccccc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H20N2O3/c19-12-15(18(23)20-14-8-4-5-9-14)17(22)11-10-16(21)13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-11H2,(H,20,23)/t15-/m1/s1 |
| InChIKey | CHGLXBWXHVYBAF-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|