C16H22N6OS — CID 87016277
8-methyl-12-[(4-propan-2-ylpiperazin-1-yl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 87016277) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 8-methyl-12-[(4-propan-2-ylpiperazin-1-yl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-methyl-12-[(4-propan-2-ylpiperazin-1-yl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 87016277 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 8-methyl-12-[(4-propan-2-ylpiperazin-1-yl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CC(C)N1CCN(Cc2nnc3n(C)c(=O)c4sccc4n23)CC1 |
| InChI | InChI=1S/C16H22N6OS/c1-11(2)21-7-5-20(6-8-21)10-13-17-18-16-19(3)15(23)14-12(22(13)16)4-9-24-14/h4,9,11H,5-8,10H2,1-3H3 |
| InChIKey | IOGKOJNMFLSTIY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |