C13H15FN4O3S — CID 87018816
N-[2-(4-fluorophenoxy)ethyl]-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 87018816) has the molecular formula C13H15FN4O3S and a molecular weight of 326.35 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 87018816 |
| Molecular Formula | C13H15FN4O3S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)NCCOc2ccc(F)cc2)n[nH]c1=O |
| InChI | InChI=1S/C13H15FN4O3S/c1-18-12(20)16-17-13(18)22-8-11(19)15-6-7-21-10-4-2-9(14)3-5-10/h2-5H,6-8H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | HOUSSKNAQNMIBY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|