C13H11N5O2S2 — CID 87022290
3-[4-methyl-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 87022290) has the molecular formula C13H11N5O2S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 3-[4-methyl-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[4-methyl-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 87022290 |
| Molecular Formula | C13H11N5O2S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-[4-methyl-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | Cn1c(SCc2csc([N+](=O)[O-])c2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C13H11N5O2S2/c1-17-12(10-3-2-4-14-6-10)15-16-13(17)22-8-9-5-11(18(19)20)21-7-9/h2-7H,8H2,1H3 |
| InChIKey | RDNIGIVYLLTFHE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|