C13H10FN5O2S2 — CID 87022293
3-(4-fluorophenyl)-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 87022293) has the molecular formula C13H10FN5O2S2 and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(4-fluorophenyl)-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 87022293 |
| Molecular Formula | C13H10FN5O2S2 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 3-(4-fluorophenyl)-5-[(5-nitrothiophen-3-yl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCc2csc([N+](=O)[O-])c2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10FN5O2S2/c14-10-3-1-9(2-4-10)12-16-17-13(18(12)15)23-7-8-5-11(19(20)21)22-6-8/h1-6H,7,15H2 |
| InChIKey | XAKCDCVUFMAJHE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|