C13H21N3O3S — CID 87023165
5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylsulfonyl]pentanenitrile (PubChem CID 87023165) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylsulfonyl]pentanenitrile.
| Compound Name | 5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylsulfonyl]pentanenitrile |
|---|---|
| PubChem CID | 87023165 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylsulfonyl]pentanenitrile |
| SMILES | CCCCc1noc(C(C)S(=O)(=O)CCCCC#N)n1 |
| InChI | InChI=1S/C13H21N3O3S/c1-3-4-8-12-15-13(19-16-12)11(2)20(17,18)10-7-5-6-9-14/h11H,3-8,10H2,1-2H3 |
| InChIKey | PZNDOZKMKNUQSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|