C13H18BrN3O2S — CID 87024134
2-[(E)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-cyclohexylacetamide (PubChem CID 87024134) has the molecular formula C13H18BrN3O2S and a molecular weight of 360.28 g/mol. Its IUPAC name is 2-[(E)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-cyclohexylacetamide.
| Compound Name | 2-[(E)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 87024134 |
| Molecular Formula | C13H18BrN3O2S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-[(E)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-cyclohexylacetamide |
| SMILES | N/C(=N/OCC(=O)NC1CCCCC1)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H18BrN3O2S/c14-9-6-11(20-8-9)13(15)17-19-7-12(18)16-10-4-2-1-3-5-10/h6,8,10H,1-5,7H2,(H2,15,17)(H,16,18) |
| InChIKey | GUVHRUPKMOFJOF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|