C15H18N2O4S — CID 87026861
N'-(3,4-dihydronaphthalen-2-ylsulfonyl)oxolane-2-carbohydrazide (PubChem CID 87026861) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N'-(3,4-dihydronaphthalen-2-ylsulfonyl)oxolane-2-carbohydrazide.
| Compound Name | N'-(3,4-dihydronaphthalen-2-ylsulfonyl)oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 87026861 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N'-(3,4-dihydronaphthalen-2-ylsulfonyl)oxolane-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)C1=Cc2ccccc2CC1)C1CCCO1 |
| InChI | InChI=1S/C15H18N2O4S/c18-15(14-6-3-9-21-14)16-17-22(19,20)13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,10,14,17H,3,6-9H2,(H,16,18) |
| InChIKey | GREZJRPYIUYQLX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|