C19H21Cl2N3O2 — CID 87033300
N-(2,5-dichlorophenyl)-2-(3-morpholin-4-ylanilino)propanamide (PubChem CID 87033300) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(3-morpholin-4-ylanilino)propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(3-morpholin-4-ylanilino)propanamide |
|---|---|
| PubChem CID | 87033300 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(3-morpholin-4-ylanilino)propanamide |
| SMILES | CC(Nc1cccc(N2CCOCC2)c1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-13(19(25)23-18-11-14(20)5-6-17(18)21)22-15-3-2-4-16(12-15)24-7-9-26-10-8-24/h2-6,11-13,22H,7-10H2,1H3,(H,23,25) |
| InChIKey | UDABWLCAXVMLPP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |