C20H23N3O3 — CID 87043960
N-[2-(dimethylcarbamoyl)phenyl]-N'-[1-(4-methylphenyl)ethyl]oxamide (PubChem CID 87043960) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoyl)phenyl]-N'-[1-(4-methylphenyl)ethyl]oxamide.
| Compound Name | N-[2-(dimethylcarbamoyl)phenyl]-N'-[1-(4-methylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 87043960 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[2-(dimethylcarbamoyl)phenyl]-N'-[1-(4-methylphenyl)ethyl]oxamide |
| SMILES | Cc1ccc(C(C)NC(=O)C(=O)Nc2ccccc2C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-9-11-15(12-10-13)14(2)21-18(24)19(25)22-17-8-6-5-7-16(17)20(26)23(3)4/h5-12,14H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | LSRFEUYQCZMFDZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|