About 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate
3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate (PubChem CID 87044338) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate |
| PubChem CID | 87044338 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate |
| SMILES | CC(C)Cc1cc(C(=O)OCCCc2ccncc2)n[nH]1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(2)10-14-11-15(19-18-14)16(20)21-9-3-4-13-5-7-17-8-6-13/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | QHSFOONJTKFRGY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate?
The IUPAC name of 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate (CID 87044338) is 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate.
What is the SMILES notation for 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate?
The canonical SMILES for 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate is CC(C)Cc1cc(C(=O)OCCCc2ccncc2)n[nH]1.
What is the InChIKey of 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate?
The InChIKey is QHSFOONJTKFRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-12(2)10-14-11-15(19-18-14)16(20)21-9-3-4-13-5-7-17-8-6-13/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,18,19).
What are the key properties of 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate?
3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate has a molecular weight of 287.36 g/mol, XLogP of 2.79, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylpropyl 5-(2-methylpropyl)-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 87044338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).