C24H22BrN3O3 — CID 87047414
N-[(Z)-3-[(3-aminophenyl)methylamino]-1-(3-bromo-4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 87047414) has the molecular formula C24H22BrN3O3 and a molecular weight of 480.36 g/mol. Its IUPAC name is N-[(Z)-3-[(3-aminophenyl)methylamino]-1-(3-bromo-4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(3-aminophenyl)methylamino]-1-(3-bromo-4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 87047414 |
| Molecular Formula | C24H22BrN3O3 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[(Z)-3-[(3-aminophenyl)methylamino]-1-(3-bromo-4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)NCc2cccc(N)c2)cc1Br |
| InChI | InChI=1S/C24H22BrN3O3/c1-31-22-11-10-16(13-20(22)25)14-21(28-23(29)18-7-3-2-4-8-18)24(30)27-15-17-6-5-9-19(26)12-17/h2-14H,15,26H2,1H3,(H,27,30)(H,28,29)/b21-14- |
| InChIKey | KUSVNCZAIUKXLP-STZFKDTASA-N |
| XLogP | 4.13 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|