C23H19ClN4OS2 — CID 87048065
2-[2-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 87048065) has the molecular formula C23H19ClN4OS2 and a molecular weight of 467.02 g/mol. Its IUPAC name is 2-[2-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[2-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 87048065 |
| Molecular Formula | C23H19ClN4OS2 |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-[2-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CSc2ccccc2/N=C/c2cccnc2Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C23H19ClN4OS2/c24-22-15(6-5-11-26-22)13-27-18-8-2-4-10-20(18)30-14-21(29)28-23-17(12-25)16-7-1-3-9-19(16)31-23/h2,4-6,8,10-11,13H,1,3,7,9,14H2,(H,28,29)/b27-13+ |
| InChIKey | PIXGJNOEMWYOLB-UVHMKAGCSA-N |
| XLogP | 6.03 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|