C15H12F2N4O3S — CID 87052564
11-(3,5-difluorophenyl)sulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 87052564) has the molecular formula C15H12F2N4O3S and a molecular weight of 366.35 g/mol. Its IUPAC name is 11-(3,5-difluorophenyl)sulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(3,5-difluorophenyl)sulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 87052564 |
| Molecular Formula | C15H12F2N4O3S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 11-(3,5-difluorophenyl)sulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc[nH]n13)CCN(S(=O)(=O)c1cc(F)cc(F)c1)C2 |
| InChI | InChI=1S/C15H12F2N4O3S/c16-9-5-10(17)7-11(6-9)25(23,24)20-4-2-13-12(8-20)15(22)21-14(19-13)1-3-18-21/h1,3,5-7,18H,2,4,8H2 |
| InChIKey | PDGNUTSRXBUCKA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |