C16H13F3N4O3S — CID 53183848
12-[3-(trifluoromethyl)phenyl]sulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183848) has the molecular formula C16H13F3N4O3S and a molecular weight of 398.37 g/mol. Its IUPAC name is 12-[3-(trifluoromethyl)phenyl]sulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-[3-(trifluoromethyl)phenyl]sulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183848 |
| Molecular Formula | C16H13F3N4O3S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 12-[3-(trifluoromethyl)phenyl]sulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc[nH]n13)CN(S(=O)(=O)c1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C16H13F3N4O3S/c17-16(18,19)10-2-1-3-11(8-10)27(25,26)22-7-5-12-13(9-22)21-14-4-6-20-23(14)15(12)24/h1-4,6,8,20H,5,7,9H2 |
| InChIKey | IXSRMENQBMZRQI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |