C20H29N3OS — CID 87054473
5-cyclopentyl-N-(3-piperidin-1-ylpropyl)thieno[2,3-c]pyrrole-2-carboxamide (PubChem CID 87054473) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)thieno[2,3-c]pyrrole-2-carboxamide.
| Compound Name | 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)thieno[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 87054473 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)thieno[2,3-c]pyrrole-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cc2cn(C3CCCC3)cc2s1 |
| InChI | InChI=1S/C20H29N3OS/c24-20(21-9-6-12-22-10-4-1-5-11-22)18-13-16-14-23(15-19(16)25-18)17-7-2-3-8-17/h13-15,17H,1-12H2,(H,21,24) |
| InChIKey | GJNCOLVQQRMBKH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|