C20H31N3OS — CID 53171311
5-cyclopentyl-N-(3-piperidin-1-ylpropyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide (PubChem CID 53171311) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide.
| Compound Name | 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 53171311 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 5-cyclopentyl-N-(3-piperidin-1-ylpropyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cc2c(s1)CN(C1CCCC1)C2 |
| InChI | InChI=1S/C20H31N3OS/c24-20(21-9-6-12-22-10-4-1-5-11-22)18-13-16-14-23(15-19(16)25-18)17-7-2-3-8-17/h13,17H,1-12,14-15H2,(H,21,24) |
| InChIKey | OXHLXPNOSVVRDF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|