C19H31N3OS — CID 53171259
N-[3-(4-methylpiperidin-1-yl)propyl]-5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide (PubChem CID 53171259) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 53171259 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)c2cc3c(s2)CN(C(C)C)C3)CC1 |
| InChI | InChI=1S/C19H31N3OS/c1-14(2)22-12-16-11-17(24-18(16)13-22)19(23)20-7-4-8-21-9-5-15(3)6-10-21/h11,14-15H,4-10,12-13H2,1-3H3,(H,20,23) |
| InChIKey | GTTXEDFNGRSOCB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|