C23H23NO3S — CID 8705633
(2R)-2-cyclohexylsulfanyl-N-(9,10-dioxoanthracen-2-yl)propanamide (PubChem CID 8705633) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R)-2-cyclohexylsulfanyl-N-(9,10-dioxoanthracen-2-yl)propanamide.
| Compound Name | (2R)-2-cyclohexylsulfanyl-N-(9,10-dioxoanthracen-2-yl)propanamide |
|---|---|
| PubChem CID | 8705633 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R)-2-cyclohexylsulfanyl-N-(9,10-dioxoanthracen-2-yl)propanamide |
| SMILES | C[C@@H](SC1CCCCC1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H23NO3S/c1-14(28-16-7-3-2-4-8-16)23(27)24-15-11-12-19-20(13-15)22(26)18-10-6-5-9-17(18)21(19)25/h5-6,9-14,16H,2-4,7-8H2,1H3,(H,24,27)/t14-/m1/s1 |
| InChIKey | SMEIPYCNCCBJMQ-CQSZACIVSA-N |
| XLogP | 4.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|