C10H22Cl4O8P2 — CID 87060109
1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;phosphoric acid (PubChem CID 87060109) has the molecular formula C10H22Cl4O8P2 and a molecular weight of 474.04 g/mol. Its IUPAC name is 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;phosphoric acid.
| Compound Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;phosphoric acid |
|---|---|
| PubChem CID | 87060109 |
| Molecular Formula | C10H22Cl4O8P2 |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;phosphoric acid |
| SMILES | ClCCC(CCCl)=C(CCCl)CCCl.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C10H16Cl4.2H3O4P/c11-5-1-9(2-6-12)10(3-7-13)4-8-14;2*1-5(2,3)4/h1-8H2;2*(H3,1,2,3,4) |
| InChIKey | DECYKLQYQQQUFT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|