C22H47NO3P+ — CID 87062105
1-[[(Z)-hexadec-7-enoxy]-hydroxyphosphoryl]propyl-trimethylazanium (PubChem CID 87062105) has the molecular formula C22H47NO3P+ and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-[[(Z)-hexadec-7-enoxy]-hydroxyphosphoryl]propyl-trimethylazanium.
| Compound Name | 1-[[(Z)-hexadec-7-enoxy]-hydroxyphosphoryl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 87062105 |
| Molecular Formula | C22H47NO3P+ |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 1-[[(Z)-hexadec-7-enoxy]-hydroxyphosphoryl]propyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCOP(=O)(O)C(CC)[N+](C)(C)C |
| InChI | InChI=1S/C22H46NO3P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-27(24,25)22(7-2)23(3,4)5/h14-15,22H,6-13,16-21H2,1-5H3/p+1/b15-14- |
| InChIKey | GTNNPJYPAXDVDV-PFONDFGASA-O |
| XLogP | 6.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|