C28H57NO3P+ — CID 91390682
1-[docosa-10,16-dienoxy(hydroxy)phosphoryl]propyl-trimethylazanium (PubChem CID 91390682) has the molecular formula C28H57NO3P+ and a molecular weight of 486.74 g/mol. Its IUPAC name is 1-[docosa-10,16-dienoxy(hydroxy)phosphoryl]propyl-trimethylazanium.
| Compound Name | 1-[docosa-10,16-dienoxy(hydroxy)phosphoryl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 91390682 |
| Molecular Formula | C28H57NO3P+ |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | 1-[docosa-10,16-dienoxy(hydroxy)phosphoryl]propyl-trimethylazanium |
| SMILES | CCCCCC=CCCCCC=CCCCCCCCCCOP(=O)(O)C(CC)[N+](C)(C)C |
| InChI | InChI=1S/C28H56NO3P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-32-33(30,31)28(7-2)29(3,4)5/h11-12,17-18,28H,6-10,13-16,19-27H2,1-5H3/p+1 |
| InChIKey | HZWCEPRMHCAFTM-UHFFFAOYSA-O |
| XLogP | 9.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|