C24H49NO4P+ — CID 87062587
[(9Z,17Z)-2-hydroxy-2-phosphonohenicosa-9,17-dienyl]-trimethylazanium (PubChem CID 87062587) has the molecular formula C24H49NO4P+ and a molecular weight of 446.63 g/mol. Its IUPAC name is [(9Z,17Z)-2-hydroxy-2-phosphonohenicosa-9,17-dienyl]-trimethylazanium.
| Compound Name | [(9Z,17Z)-2-hydroxy-2-phosphonohenicosa-9,17-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062587 |
| Molecular Formula | C24H49NO4P+ |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | [(9Z,17Z)-2-hydroxy-2-phosphonohenicosa-9,17-dienyl]-trimethylazanium |
| SMILES | CCC/C=C\CCCCCC/C=C\CCCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C24H48NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(26,30(27,28)29)23-25(2,3)4/h7-8,15-16,26H,5-6,9-14,17-23H2,1-4H3,(H-,27,28,29)/p+1/b8-7-,16-15- |
| InChIKey | WJVMKVZAULWGAU-DRGLTMLKSA-O |
| XLogP | 6.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|