C30H61NO4P+ — CID 87062614
[(12Z,22Z)-2-hydroxy-2-phosphonoheptacosa-12,22-dienyl]-trimethylazanium (PubChem CID 87062614) has the molecular formula C30H61NO4P+ and a molecular weight of 530.80 g/mol. Its IUPAC name is [(12Z,22Z)-2-hydroxy-2-phosphonoheptacosa-12,22-dienyl]-trimethylazanium.
| Compound Name | [(12Z,22Z)-2-hydroxy-2-phosphonoheptacosa-12,22-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062614 |
| Molecular Formula | C30H61NO4P+ |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | [(12Z,22Z)-2-hydroxy-2-phosphonoheptacosa-12,22-dienyl]-trimethylazanium |
| SMILES | CCCC/C=C\CCCCCCCC/C=C\CCCCCCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C30H60NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30(32,36(33,34)35)29-31(2,3)4/h8-9,18-19,32H,5-7,10-17,20-29H2,1-4H3,(H-,33,34,35)/p+1/b9-8-,19-18- |
| InChIKey | ISDDMNGSBNDAAH-HAZWQPCJSA-O |
| XLogP | 8.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|