C26H53NO4P+ — CID 87062964
[(11Z,15Z)-2-hydroxy-2-phosphonotricosa-11,15-dienyl]-trimethylazanium (PubChem CID 87062964) has the molecular formula C26H53NO4P+ and a molecular weight of 474.69 g/mol. Its IUPAC name is [(11Z,15Z)-2-hydroxy-2-phosphonotricosa-11,15-dienyl]-trimethylazanium.
| Compound Name | [(11Z,15Z)-2-hydroxy-2-phosphonotricosa-11,15-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062964 |
| Molecular Formula | C26H53NO4P+ |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | [(11Z,15Z)-2-hydroxy-2-phosphonotricosa-11,15-dienyl]-trimethylazanium |
| SMILES | CCCCCCC/C=C\CC/C=C\CCCCCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C26H52NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26(28,32(29,30)31)25-27(2,3)4/h11-12,15-16,28H,5-10,13-14,17-25H2,1-4H3,(H-,29,30,31)/p+1/b12-11-,16-15- |
| InChIKey | GVFVQOQAXHPDPL-ATNUXVQMSA-O |
| XLogP | 6.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|