C26H55NO6P+ — CID 87063058
(2S)-1-[(6Z,12Z)-hexadeca-6,12-dienoxy]-3-methoxypropan-2-ol;trimethyl(2-phosphonopropyl)azanium (PubChem CID 87063058) has the molecular formula C26H55NO6P+ and a molecular weight of 508.70 g/mol. Its IUPAC name is (2S)-1-[(6Z,12Z)-hexadeca-6,12-dienoxy]-3-methoxypropan-2-ol;trimethyl(2-phosphonopropyl)azanium.
| Compound Name | (2S)-1-[(6Z,12Z)-hexadeca-6,12-dienoxy]-3-methoxypropan-2-ol;trimethyl(2-phosphonopropyl)azanium |
|---|---|
| PubChem CID | 87063058 |
| Molecular Formula | C26H55NO6P+ |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (2S)-1-[(6Z,12Z)-hexadeca-6,12-dienoxy]-3-methoxypropan-2-ol;trimethyl(2-phosphonopropyl)azanium |
| SMILES | CC(C[N+](C)(C)C)P(=O)(O)O.CCC/C=C\CCCC/C=C\CCCCCOC[C@@H](O)COC |
| InChI | InChI=1S/C20H38O3.C6H16NO3P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-19-20(21)18-22-2;1-6(11(8,9)10)5-7(2,3)4/h5-6,11-12,20-21H,3-4,7-10,13-19H2,1-2H3;6H,5H2,1-4H3,(H-,8,9,10)/p+1/b6-5-,12-11-;/t20-;/m0./s1 |
| InChIKey | CYERVVQELULYDO-CBMDDDGISA-O |
| XLogP | 5.30 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|