C28H59NO6P+ — CID 87063124
(2S)-1-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propan-2-ol;trimethyl(2-phosphonopropyl)azanium (PubChem CID 87063124) has the molecular formula C28H59NO6P+ and a molecular weight of 536.76 g/mol. Its IUPAC name is (2S)-1-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propan-2-ol;trimethyl(2-phosphonopropyl)azanium.
| Compound Name | (2S)-1-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propan-2-ol;trimethyl(2-phosphonopropyl)azanium |
|---|---|
| PubChem CID | 87063124 |
| Molecular Formula | C28H59NO6P+ |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | (2S)-1-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propan-2-ol;trimethyl(2-phosphonopropyl)azanium |
| SMILES | CC(C[N+](C)(C)C)P(=O)(O)O.CCCCC/C=C\CCCC/C=C\CCCCCOC[C@@H](O)COC |
| InChI | InChI=1S/C22H42O3.C6H16NO3P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-21-22(23)20-24-2;1-6(11(8,9)10)5-7(2,3)4/h7-8,13-14,22-23H,3-6,9-12,15-21H2,1-2H3;6H,5H2,1-4H3,(H-,8,9,10)/p+1/b8-7-,14-13-;/t22-;/m0./s1 |
| InChIKey | FVTZQURFOXXZAA-NNDGKYNZSA-O |
| XLogP | 6.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|