C24H20F4N2O6 — CID 87064395
(3S)-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 87064395) has the molecular formula C24H20F4N2O6 and a molecular weight of 508.42 g/mol. Its IUPAC name is (3S)-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 87064395 |
| Molecular Formula | C24H20F4N2O6 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (3S)-4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CCC(C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F)n1ccc2ccccc2c1=O |
| InChI | InChI=1S/C24H20F4N2O6/c1-2-17(30-8-7-12-5-3-4-6-13(12)24(30)35)23(34)29-16(10-19(32)33)18(31)11-36-22-20(27)14(25)9-15(26)21(22)28/h3-9,16-17H,2,10-11H2,1H3,(H,29,34)(H,32,33)/t16-,17?/m0/s1 |
| InChIKey | FOLFSRNDQOLNTG-BHWOMJMDSA-N |
| XLogP | 3.12 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|