C32H40F6N4O3 — CID 87066489
2-[(4R)-4-(2,3-dihydro-1-benzofuran-5-yl)-4-methylimidazolidin-1-yl]-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 87066489) has the molecular formula C32H40F6N4O3 and a molecular weight of 642.69 g/mol. Its IUPAC name is 2-[(4R)-4-(2,3-dihydro-1-benzofuran-5-yl)-4-methylimidazolidin-1-yl]-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(4R)-4-(2,3-dihydro-1-benzofuran-5-yl)-4-methylimidazolidin-1-yl]-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 87066489 |
| Molecular Formula | C32H40F6N4O3 |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 2-[(4R)-4-(2,3-dihydro-1-benzofuran-5-yl)-4-methylimidazolidin-1-yl]-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N1CC(C)N(C(=O)CN2CN[C@](C)(c3ccc4c(c3)CCO4)C2)CC1C |
| InChI | InChI=1S/C32H40F6N4O3/c1-5-6-22-13-25(30(44,31(33,34)35)32(36,37)38)7-9-26(22)41-15-21(3)42(16-20(41)2)28(43)17-40-18-29(4,39-19-40)24-8-10-27-23(14-24)11-12-45-27/h7-10,13-14,20-21,39,44H,5-6,11-12,15-19H2,1-4H3/t20?,21?,29-/m0/s1 |
| InChIKey | AXQJDUCWPIVVNH-KRGKPIPQSA-N |
| XLogP | 5.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|