C22H25BrN6O3 — CID 87067742
tert-butyl 4-[2-(2-bromopyridine-4-carbonyl)-1H-imidazo[4,5-b]pyridin-5-yl]diazepane-1-carboxylate (PubChem CID 87067742) has the molecular formula C22H25BrN6O3 and a molecular weight of 501.39 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-bromopyridine-4-carbonyl)-1H-imidazo[4,5-b]pyridin-5-yl]diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-bromopyridine-4-carbonyl)-1H-imidazo[4,5-b]pyridin-5-yl]diazepane-1-carboxylate |
|---|---|
| PubChem CID | 87067742 |
| Molecular Formula | C22H25BrN6O3 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | tert-butyl 4-[2-(2-bromopyridine-4-carbonyl)-1H-imidazo[4,5-b]pyridin-5-yl]diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc3[nH]c(C(=O)c4ccnc(Br)c4)nc3n2)CN1 |
| InChI | InChI=1S/C22H25BrN6O3/c1-22(2,3)32-21(31)29-10-4-5-14(12-25-29)15-6-7-16-19(26-15)28-20(27-16)18(30)13-8-9-24-17(23)11-13/h6-9,11,14,25H,4-5,10,12H2,1-3H3,(H,26,27,28) |
| InChIKey | UAZIIQPGXDHRMC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|