About CID 87071664
CID 87071664 (PubChem CID 87071664) has the molecular formula CH2KO3Zr
and a molecular weight of 192.35 g/mol.
Molecular Properties
| Compound Name | CID 87071664 |
| PubChem CID | 87071664 |
| Molecular Formula | CH2KO3Zr |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 190.87 |
| IUPAC Name | — |
| SMILES | O=C(O)O.[K].[Zr] |
| InChI | InChI=1S/CH2O3.K.Zr/c2-1(3)4;;/h(H2,2,3,4);; |
| InChIKey | DHKIPJJAPHSULU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87071664 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87071664?
The IUPAC name of CID 87071664 (CID 87071664) is not available.
What is the SMILES notation for CID 87071664?
The canonical SMILES for CID 87071664 is O=C(O)O.[K].[Zr].
What is the InChIKey of CID 87071664?
The InChIKey is DHKIPJJAPHSULU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.K.Zr/c2-1(3)4;;/h(H2,2,3,4);;.
What are the key properties of CID 87071664?
CID 87071664 has a molecular weight of 192.35 g/mol, XLogP of -0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87071664 is sourced from PubChem (CID 87071664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).