C16H8N2Na2O6S4 — CID 87072457
disodium;2-[1,2-diisothiocyanato-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 87072457) has the molecular formula C16H8N2Na2O6S4 and a molecular weight of 498.50 g/mol. Its IUPAC name is disodium;2-[1,2-diisothiocyanato-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | disodium;2-[1,2-diisothiocyanato-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 87072457 |
| Molecular Formula | C16H8N2Na2O6S4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 497.91 |
| IUPAC Name | disodium;2-[1,2-diisothiocyanato-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1C(N=C=S)=C(N=C=S)c1ccccc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H10N2O6S4.2Na/c19-27(20,21)13-7-3-1-5-11(13)15(17-9-25)16(18-10-26)12-6-2-4-8-14(12)28(22,23)24;;/h1-8H,(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2 |
| InChIKey | ZURGMLUCNCRGFC-UHFFFAOYSA-L |
| XLogP | -3.47 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|