About 2-iodobenzoyl isothiocyanate
2-iodobenzoyl isothiocyanate (PubChem CID 15650510) has the molecular formula C8H4INOS
and a molecular weight of 289.10 g/mol. Its IUPAC name is 2-iodobenzoyl isothiocyanate.
Molecular Properties
| Compound Name | 2-iodobenzoyl isothiocyanate |
| PubChem CID | 15650510 |
| Molecular Formula | C8H4INOS |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 288.91 |
| IUPAC Name | 2-iodobenzoyl isothiocyanate |
| SMILES | O=C(N=C=S)c1ccccc1I |
| InChI | InChI=1S/C8H4INOS/c9-7-4-2-1-3-6(7)8(11)10-5-12/h1-4H |
| InChIKey | OGGLVWZTEISGJW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobenzoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobenzoyl isothiocyanate?
The IUPAC name of 2-iodobenzoyl isothiocyanate (CID 15650510) is 2-iodobenzoyl isothiocyanate.
What is the SMILES notation for 2-iodobenzoyl isothiocyanate?
The canonical SMILES for 2-iodobenzoyl isothiocyanate is O=C(N=C=S)c1ccccc1I.
What is the InChIKey of 2-iodobenzoyl isothiocyanate?
The InChIKey is OGGLVWZTEISGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4INOS/c9-7-4-2-1-3-6(7)8(11)10-5-12/h1-4H.
What are the key properties of 2-iodobenzoyl isothiocyanate?
2-iodobenzoyl isothiocyanate has a molecular weight of 289.10 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobenzoyl isothiocyanate is sourced from PubChem (CID 15650510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).