C24H23N3O3 — CID 87072732
4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-(1-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-3-yl)benzamide (PubChem CID 87072732) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-(1-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-3-yl)benzamide.
| Compound Name | 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-(1-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 87072732 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-(1-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-3-yl)benzamide |
| SMILES | CC(C)C1(NC(=O)c2ccc(C#CC#Cc3ccc(N)cc3)cc2)CCN(O)C1=O |
| InChI | InChI=1S/C24H23N3O3/c1-17(2)24(15-16-27(30)23(24)29)26-22(28)20-11-7-18(8-12-20)5-3-4-6-19-9-13-21(25)14-10-19/h7-14,17,30H,15-16,25H2,1-2H3,(H,26,28) |
| InChIKey | SGBFUHMVARNLKP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|