C22H19N3O3 — CID 56928269
1-[4-[4-(4-aminophenyl)buta-1,3-diynyl]benzoyl]-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 56928269) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[4-[4-(4-aminophenyl)buta-1,3-diynyl]benzoyl]-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[4-(4-aminophenyl)buta-1,3-diynyl]benzoyl]-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56928269 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[4-[4-(4-aminophenyl)buta-1,3-diynyl]benzoyl]-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | Nc1ccc(C#CC#Cc2ccc(C(=O)N3CCCC3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c23-19-13-9-17(10-14-19)5-2-1-4-16-7-11-18(12-8-16)22(27)25-15-3-6-20(25)21(26)24-28/h7-14,20,28H,3,6,15,23H2,(H,24,26) |
| InChIKey | QLBXVIIWMPETDM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|